Aminobenzoic acids and derivatives
Medchemexpress LLC 3-ketoadipic acid | 689-31-6 | MFCD00010003 | 95.0% | 160.12 g/mol | C6H8O5 | 5mg
3-Ketoadipic acid is a dicarboxylic acid containing a keto group that can be isolated from Brazilian propolis (Et-Bra) Brazilian propolis exhibits antibacterial antifungal and antiparasitic activities[1]
Chemscene Biuret | 1kg | CS-W016643 | 95% | 108-19-0 | MFCD00007946 | 103 08 | C2H5N3O2
Chemscene | Biuret | 1kg | CS-W016643 | 95% | 108-19-0 | MFCD00007946 | 103 08 | C2H5N3O2
Medchemexpress LLC Dihydroartemisinic acid | 85031-59-0 | 1 ML
Dihydroartemisinic acid (Dihydroqinghao acid) is a biosynthetic precursor to the antimalarial agent Artemisinin. This compound is intended for research use only.
- Biosynthetic precursor to antimalarial agent Artemisinin
- Target: Plasmodium
- Target: Ferroptosis
- Pathway: Anti-infection
- Pathway: Apoptosis
- Purity: 99.58%
- Molecular Weight: 236.35
- Molecular Formula: C15H24O2
- Appearance: White to off-white solid
eMolecules 1255666-48-8 | tert-Butyl 4-amino-3,3-difluoropiperidine-1-carboxylate | Ambeed | MFCD16250242 | 236.263 | C10H18F2N2O2 | 95.000 | CC(C)(C)OC(=O)N1CCC(N)C(F)(F)C1 | 10g | 816453386
tert-Butyl 4-amino-3,3-difluoropiperidine-1-carboxylate | Ambeed | 1255666-48-8 | MFCD16250242 | 236.263 | C10H18F2N2O2 | 95.000 | CC(C)(C)OC(=O)N1CCC(N)C(F)(F)C1 | 10g | 816453386
eMolecules 1374014-30-8 | 3-(Bromomethyl)oxetane | Accela ChemBio (ASD) | MFCD20278240 | 151.003 | C4H7BrO | 97.000 | BrCC1COC1 | 25g | 712752035
3-(Bromomethyl)oxetane | Accela ChemBio (ASD) | 1374014-30-8 | MFCD20278240 | 151.003 | C4H7BrO | 97.000 | BrCC1COC1 | 25g | 712752035
Chemscene (S)-RuCl[(p-cymene(BINAP)]Cl | 25g | CS-W009293 | 98% | 130004-33-0 | MFCD00134456 | 928 87 | C54H46Cl2P2Ru
Chemscene | (S)-RuCl[(p-cymene(BINAP)]Cl | 25g | CS-W009293 | 98% | 130004-33-0 | MFCD00134456 | 928 87 | C54H46Cl2P2Ru
Medchemexpress LLC 9-amino-6-chloro-2-methoxyacridine | 602166 | MFCD07374304 | 99.6% | 258.70 | C14H11ClN2O | 5 MG
9-Amino-6-chloro-2-methoxyacridine (ACMA) is a pH-sensitive fluorescent probe used to monitor changes in vacuolar and membrane compartment pH and to study proton gradients and H+/solute antiport activity in biological assays.
- pH-sensitive fluorescent probe suitable for monitoring vacuolar and membrane pH.
- High purity (99.56%), suitable for analytical and research applications.
- Molecular weight 258.70 and formula C14H11ClN2O.
- Offered as small-mass solids (5 mg, 10 mg, 25 mg) and as 10 mM solutions in DMSO.
- Commonly used in assays of proton gradients and H+/solute antiport systems.
Chemscene 5-Bromo[1 2 4]triazolo[1 5-a]pyridin-2-amine | 1g | CS-W008854 | 98% | 1010120-55-4 | MFCD11655928 | 213 038 | C6H5BrN4
Chemscene | 5-Bromo[1 2 4]triazolo[1 5-a]pyridin-2-amine | 1g | CS-W008854 | 98% | 1010120-55-4 | MFCD11655928 | 213 038 | C6H5BrN4
Chemscene 3-Nitrophenylboronic acid | 25g | CS-W007413 | 98% | 13331-27-6 | MFCD00007193 | 166 93 | C6H6BNO4
Chemscene | 3-Nitrophenylboronic acid | 25g | CS-W007413 | 98% | 13331-27-6 | MFCD00007193 | 166 93 | C6H6BNO4
Chemscene -Hexylcinnamaldehyde | 500g | CS-W014834 | 92% | 101-86-0 | MFCD00006989 | 216 32 | C15H20O
Chemscene | -Hexylcinnamaldehyde | 500g | CS-W014834 | 92% | 101-86-0 | MFCD00006989 | 216 32 | C15H20O
Chemscene (2 6-Difluoro-3-nitrophenyl)boronic acid | 1g | CS-W015485 | 98% | 1150114-28-5 | MFCD12025957 | 202 91 | C6H4BF2NO4
Chemscene | (2 6-Difluoro-3-nitrophenyl)boronic acid | 1g | CS-W015485 | 98% | 1150114-28-5 | MFCD12025957 | 202 91 | C6H4BF2NO4
Chemscene Methyl 1H-pyrrole-2-carboxylate | 10g | CS-W013518 | 98% | 1193-62-0 | MFCD00817048 | 125 13 | C6H7NO2
Chemscene | Methyl 1H-pyrrole-2-carboxylate | 10g | CS-W013518 | 98% | 1193-62-0 | MFCD00817048 | 125 13 | C6H7NO2
Chemscene Ethyl 1-methyl-3-(trifluoromethyl)-1H-pyrazole-4-carboxylate | 5g | CS-W014721 | 98% | 111493-74-4 | MFCD02083398 | 222 17 | C8H9F3N2O2
Chemscene | Ethyl 1-methyl-3-(trifluoromethyl)-1H-pyrazole-4-carboxylate | 5g | CS-W014721 | 98% | 111493-74-4 | MFCD02083398 | 222 17 | C8H9F3N2O2
Chemscene Xylometazoline (hydrochloride) | 25g | CS-2589 | 98% | 1218-35-5 | MFCD00238707 | 280 84 | C16H25ClN2
Chemscene | Xylometazoline (hydrochloride) | 25g | CS-2589 | 98% | 1218-35-5 | MFCD00238707 | 280 84 | C16H25ClN2
Chemscene 2 3-Difluorophenylboronic acid | 100g | CS-W020412 | 98% | 121219-16-7 | MFCD01863170 | 157 91 | C6H5BF2O2
Chemscene | 2 3-Difluorophenylboronic acid | 100g | CS-W020412 | 98% | 121219-16-7 | MFCD01863170 | 157 91 | C6H5BF2O2